C18H23N3O2 — CID 167293608
3-(5-piperidin-4-yl-1,3-dihydroisoindol-2-yl)piperidine-2,6-dione (PubChem CID 167293608) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-(5-piperidin-4-yl-1,3-dihydroisoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(5-piperidin-4-yl-1,3-dihydroisoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 167293608 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 3-(5-piperidin-4-yl-1,3-dihydroisoindol-2-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(C4CCNCC4)cc3C2)C(=O)N1 |
| InChI | InChI=1S/C18H23N3O2/c22-17-4-3-16(18(23)20-17)21-10-14-2-1-13(9-15(14)11-21)12-5-7-19-8-6-12/h1-2,9,12,16,19H,3-8,10-11H2,(H,20,22,23) |
| InChIKey | GBADKQGXSPLYEG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|