C17H19ClN4O2 — CID 178017573
3-(3-chloro-5-piperidin-4-ylindazol-1-yl)piperidine-2,6-dione (PubChem CID 178017573) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is 3-(3-chloro-5-piperidin-4-ylindazol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(3-chloro-5-piperidin-4-ylindazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 178017573 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 3-(3-chloro-5-piperidin-4-ylindazol-1-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(n2nc(Cl)c3cc(C4CCNCC4)ccc32)C(=O)N1 |
| InChI | InChI=1S/C17H19ClN4O2/c18-16-12-9-11(10-5-7-19-8-6-10)1-2-13(12)22(21-16)14-3-4-15(23)20-17(14)24/h1-2,9-10,14,19H,3-8H2,(H,20,23,24) |
| InChIKey | XKOYDZJFDLPELH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|