C17H21ClN4O3 — CID 155923300
3-(7-oxo-3-piperidin-4-yl-5H-pyrrolo[3,4-b]pyridin-6-yl)piperidine-2,6-dione;hydrochloride (PubChem CID 155923300) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is 3-(7-oxo-3-piperidin-4-yl-5H-pyrrolo[3,4-b]pyridin-6-yl)piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-(7-oxo-3-piperidin-4-yl-5H-pyrrolo[3,4-b]pyridin-6-yl)piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 155923300 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 3-(7-oxo-3-piperidin-4-yl-5H-pyrrolo[3,4-b]pyridin-6-yl)piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.O=C1CCC(N2Cc3cc(C4CCNCC4)cnc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C17H20N4O3.ClH/c22-14-2-1-13(16(23)20-14)21-9-12-7-11(8-19-15(12)17(21)24)10-3-5-18-6-4-10;/h7-8,10,13,18H,1-6,9H2,(H,20,22,23);1H |
| InChIKey | KKTDTJQTFJJGCT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|