C12H12N4O3 — CID 155219572
3-(3-methyl-5-oxo-7H-pyrrolo[3,4-b]pyrazin-6-yl)piperidine-2,6-dione (PubChem CID 155219572) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is 3-(3-methyl-5-oxo-7H-pyrrolo[3,4-b]pyrazin-6-yl)piperidine-2,6-dione.
| Compound Name | 3-(3-methyl-5-oxo-7H-pyrrolo[3,4-b]pyrazin-6-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 155219572 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 3-(3-methyl-5-oxo-7H-pyrrolo[3,4-b]pyrazin-6-yl)piperidine-2,6-dione |
| SMILES | Cc1cnc2c(n1)C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C12H12N4O3/c1-6-4-13-7-5-16(12(19)10(7)14-6)8-2-3-9(17)15-11(8)18/h4,8H,2-3,5H2,1H3,(H,15,17,18) |
| InChIKey | ZUYOAFPGUGMMLK-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|