C14H14N4O4 — CID 164919735
6-(2,6-dioxopiperidin-3-yl)-3-propan-2-ylpyrrolo[3,4-b]pyrazine-5,7-dione (PubChem CID 164919735) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is 6-(2,6-dioxopiperidin-3-yl)-3-propan-2-ylpyrrolo[3,4-b]pyrazine-5,7-dione.
| Compound Name | 6-(2,6-dioxopiperidin-3-yl)-3-propan-2-ylpyrrolo[3,4-b]pyrazine-5,7-dione |
|---|---|
| PubChem CID | 164919735 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 6-(2,6-dioxopiperidin-3-yl)-3-propan-2-ylpyrrolo[3,4-b]pyrazine-5,7-dione |
| SMILES | CC(C)c1cnc2c(n1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C14H14N4O4/c1-6(2)7-5-15-10-11(16-7)14(22)18(13(10)21)8-3-4-9(19)17-12(8)20/h5-6,8H,3-4H2,1-2H3,(H,17,19,20) |
| InChIKey | KWEMPSCZYIGOKQ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|