C15H10IN3O3 — CID 163258969
3-(7-iodo-3-oxo-2,5-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl)piperidine-2,6-dione (PubChem CID 163258969) has the molecular formula C15H10IN3O3 and a molecular weight of 407.17 g/mol. Its IUPAC name is 3-(7-iodo-3-oxo-2,5-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(7-iodo-3-oxo-2,5-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 163258969 |
| Molecular Formula | C15H10IN3O3 |
| Molecular Weight | 407.17 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | 3-(7-iodo-3-oxo-2,5-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2C(=O)c3ncc(I)c4cccc2c34)C(=O)N1 |
| InChI | InChI=1S/C15H10IN3O3/c16-8-6-17-13-12-7(8)2-1-3-9(12)19(15(13)22)10-4-5-11(20)18-14(10)21/h1-3,6,10H,4-5H2,(H,18,20,21) |
| InChIKey | OMVZUJGIVHPZBE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|