C17H11N3O3 — CID 155194697
1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indole-6-carbonitrile (PubChem CID 155194697) has the molecular formula C17H11N3O3 and a molecular weight of 305.29 g/mol. Its IUPAC name is 1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indole-6-carbonitrile.
| Compound Name | 1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indole-6-carbonitrile |
|---|---|
| PubChem CID | 155194697 |
| Molecular Formula | C17H11N3O3 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indole-6-carbonitrile |
| SMILES | N#Cc1ccc2c3c(cccc13)C(=O)N2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C17H11N3O3/c18-8-9-4-5-12-15-10(9)2-1-3-11(15)17(23)20(12)13-6-7-14(21)19-16(13)22/h1-5,13H,6-7H2,(H,19,21,22) |
| InChIKey | JGUUZMWHXFBMJF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|