C18H13N5O3S — CID 155710450
3-[2-oxo-6-(2H-triazol-4-ylsulfanyl)benzo[cd]indol-1-yl]piperidine-2,6-dione (PubChem CID 155710450) has the molecular formula C18H13N5O3S and a molecular weight of 379.40 g/mol. Its IUPAC name is 3-[2-oxo-6-(2H-triazol-4-ylsulfanyl)benzo[cd]indol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-oxo-6-(2H-triazol-4-ylsulfanyl)benzo[cd]indol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155710450 |
| Molecular Formula | C18H13N5O3S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 3-[2-oxo-6-(2H-triazol-4-ylsulfanyl)benzo[cd]indol-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc4c(Sc5cn[nH]n5)ccc2c34)C(=O)N1 |
| InChI | InChI=1S/C18H13N5O3S/c24-14-7-5-12(17(25)20-14)23-11-4-6-13(27-15-8-19-22-21-15)9-2-1-3-10(16(9)11)18(23)26/h1-4,6,8,12H,5,7H2,(H,19,21,22)(H,20,24,25) |
| InChIKey | ZWRORZAJRGKISO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|