C19H13FN4O3S — CID 155710675
3-[9-[fluoro(1,3-thiazol-5-yl)methyl]-3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione (PubChem CID 155710675) has the molecular formula C19H13FN4O3S and a molecular weight of 396.40 g/mol. Its IUPAC name is 3-[9-[fluoro(1,3-thiazol-5-yl)methyl]-3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[9-[fluoro(1,3-thiazol-5-yl)methyl]-3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155710675 |
| Molecular Formula | C19H13FN4O3S |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 3-[9-[fluoro(1,3-thiazol-5-yl)methyl]-3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc4c(C(F)c5cncs5)ncc2c34)C(=O)N1 |
| InChI | InChI=1S/C19H13FN4O3S/c20-16(13-7-21-8-28-13)17-9-2-1-3-10-15(9)12(6-22-17)24(19(10)27)11-4-5-14(25)23-18(11)26/h1-3,6-8,11,16H,4-5H2,(H,23,25,26) |
| InChIKey | JLEQZCRWMMTCDI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|