C19H15N5O3S2 — CID 167187631
3-[9-[amino-(5-sulfanyl-1,3-thiazol-2-yl)methyl]-3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione (PubChem CID 167187631) has the molecular formula C19H15N5O3S2 and a molecular weight of 425.50 g/mol. Its IUPAC name is 3-[9-[amino-(5-sulfanyl-1,3-thiazol-2-yl)methyl]-3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[9-[amino-(5-sulfanyl-1,3-thiazol-2-yl)methyl]-3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167187631 |
| Molecular Formula | C19H15N5O3S2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 3-[9-[amino-(5-sulfanyl-1,3-thiazol-2-yl)methyl]-3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione |
| SMILES | NC(c1ncc(S)s1)c1ncc2c3c(cccc13)C(=O)N2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C19H15N5O3S2/c20-15(18-22-7-13(28)29-18)16-8-2-1-3-9-14(8)11(6-21-16)24(19(9)27)10-4-5-12(25)23-17(10)26/h1-3,6-7,10,15,28H,4-5,20H2,(H,23,25,26) |
| InChIKey | HWXCSZDPHUONOS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|