C16H12N2O3S — CID 163258587
3-(2-oxo-5-sulfanylbenzo[cd]indol-1-yl)piperidine-2,6-dione (PubChem CID 163258587) has the molecular formula C16H12N2O3S and a molecular weight of 312.35 g/mol. Its IUPAC name is 3-(2-oxo-5-sulfanylbenzo[cd]indol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(2-oxo-5-sulfanylbenzo[cd]indol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 163258587 |
| Molecular Formula | C16H12N2O3S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 3-(2-oxo-5-sulfanylbenzo[cd]indol-1-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(S)c4cccc2c34)C(=O)N1 |
| InChI | InChI=1S/C16H12N2O3S/c19-13-7-5-11(15(20)17-13)18-10-3-1-2-8-12(22)6-4-9(14(8)10)16(18)21/h1-4,6,11,22H,5,7H2,(H,17,19,20) |
| InChIKey | LSXUDPSGZRLSME-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|