C15H10N2O3 — CID 167009255
3-(2-oxobenzo[cd]indol-1-yl)pyrrolidine-2,5-dione (PubChem CID 167009255) has the molecular formula C15H10N2O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 3-(2-oxobenzo[cd]indol-1-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(2-oxobenzo[cd]indol-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 167009255 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3-(2-oxobenzo[cd]indol-1-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2C(=O)c3cccc4cccc2c34)C(=O)N1 |
| InChI | InChI=1S/C15H10N2O3/c18-12-7-11(14(19)16-12)17-10-6-2-4-8-3-1-5-9(13(8)10)15(17)20/h1-6,11H,7H2,(H,16,18,19) |
| InChIKey | JDKMNCISEDLSIC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|