C17H14N2O5S — CID 167009203
3-(4-methylsulfonyl-2-oxobenzo[cd]indol-1-yl)piperidine-2,6-dione (PubChem CID 167009203) has the molecular formula C17H14N2O5S and a molecular weight of 358.38 g/mol. Its IUPAC name is 3-(4-methylsulfonyl-2-oxobenzo[cd]indol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-methylsulfonyl-2-oxobenzo[cd]indol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 167009203 |
| Molecular Formula | C17H14N2O5S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 3-(4-methylsulfonyl-2-oxobenzo[cd]indol-1-yl)piperidine-2,6-dione |
| SMILES | CS(=O)(=O)c1cc2c3c(cccc3c1)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C17H14N2O5S/c1-25(23,24)10-7-9-3-2-4-12-15(9)11(8-10)17(22)19(12)13-5-6-14(20)18-16(13)21/h2-4,7-8,13H,5-6H2,1H3,(H,18,20,21) |
| InChIKey | VWKMMZDVLSYXLX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|