C24H27N3O5 — CID 177280181
tert-butyl N-[3-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-4-yl]propyl]carbamate (PubChem CID 177280181) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is tert-butyl N-[3-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-4-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-4-yl]propyl]carbamate |
|---|---|
| PubChem CID | 177280181 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | tert-butyl N-[3-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-4-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCc1cc2c3c(cccc3c1)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H27N3O5/c1-24(2,3)32-23(31)25-11-5-6-14-12-15-7-4-8-17-20(15)16(13-14)22(30)27(17)18-9-10-19(28)26-21(18)29/h4,7-8,12-13,18H,5-6,9-11H2,1-3H3,(H,25,31)(H,26,28,29) |
| InChIKey | JLDMNPFRLKRRTK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|