C25H33N5O7 — CID 140857053
tert-butyl N-[4-[[2-[[2-[(3S)-2,7-dioxoazepan-3-yl]-1,3-dioxoisoindol-4-yl]amino]-2-oxoethyl]amino]butyl]carbamate (PubChem CID 140857053) has the molecular formula C25H33N5O7 and a molecular weight of 515.57 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-[[2-[(3S)-2,7-dioxoazepan-3-yl]-1,3-dioxoisoindol-4-yl]amino]-2-oxoethyl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-[[2-[(3S)-2,7-dioxoazepan-3-yl]-1,3-dioxoisoindol-4-yl]amino]-2-oxoethyl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 140857053 |
| Molecular Formula | C25H33N5O7 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | tert-butyl N-[4-[[2-[[2-[(3S)-2,7-dioxoazepan-3-yl]-1,3-dioxoisoindol-4-yl]amino]-2-oxoethyl]amino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNCC(=O)Nc1cccc2c1C(=O)N([C@H]1CCCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C25H33N5O7/c1-25(2,3)37-24(36)27-13-5-4-12-26-14-19(32)28-16-9-6-8-15-20(16)23(35)30(22(15)34)17-10-7-11-18(31)29-21(17)33/h6,8-9,17,26H,4-5,7,10-14H2,1-3H3,(H,27,36)(H,28,32)(H,29,31,33)/t17-/m0/s1 |
| InChIKey | PTOFAMGXTHLCMW-KRWDZBQOSA-N |
| XLogP | 1.31 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|