C25H26FN3O5 — CID 163259082
3-[1-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-4-yl]-4-fluoropiperidin-4-yl]-2-methylpropanoic acid (PubChem CID 163259082) has the molecular formula C25H26FN3O5 and a molecular weight of 467.50 g/mol. Its IUPAC name is 3-[1-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-4-yl]-4-fluoropiperidin-4-yl]-2-methylpropanoic acid.
| Compound Name | 3-[1-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-4-yl]-4-fluoropiperidin-4-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 163259082 |
| Molecular Formula | C25H26FN3O5 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 3-[1-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-4-yl]-4-fluoropiperidin-4-yl]-2-methylpropanoic acid |
| SMILES | CC(CC1(F)CCN(c2cc3c4c(cccc4c2)N(C2CCC(=O)NC2=O)C3=O)CC1)C(=O)O |
| InChI | InChI=1S/C25H26FN3O5/c1-14(24(33)34)13-25(26)7-9-28(10-8-25)16-11-15-3-2-4-18-21(15)17(12-16)23(32)29(18)19-5-6-20(30)27-22(19)31/h2-4,11-12,14,19H,5-10,13H2,1H3,(H,33,34)(H,27,30,31) |
| InChIKey | OELUEYORQKFPOR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|