C27H31N3O5 — CID 163259384
3-[1-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-4-yl]-4-methoxypiperidin-4-yl]-2,2-dimethylpropanal (PubChem CID 163259384) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is 3-[1-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-4-yl]-4-methoxypiperidin-4-yl]-2,2-dimethylpropanal.
| Compound Name | 3-[1-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-4-yl]-4-methoxypiperidin-4-yl]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 163259384 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 3-[1-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-4-yl]-4-methoxypiperidin-4-yl]-2,2-dimethylpropanal |
| SMILES | COC1(CC(C)(C)C=O)CCN(c2cc3c4c(cccc4c2)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C27H31N3O5/c1-26(2,16-31)15-27(35-3)9-11-29(12-10-27)18-13-17-5-4-6-20-23(17)19(14-18)25(34)30(20)21-7-8-22(32)28-24(21)33/h4-6,13-14,16,21H,7-12,15H2,1-3H3,(H,28,32,33) |
| InChIKey | NNCUPNXIVINLNC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|