C22H15N5O3S — CID 155710381
3-[3-oxo-9-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfanyl)-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione (PubChem CID 155710381) has the molecular formula C22H15N5O3S and a molecular weight of 429.46 g/mol. Its IUPAC name is 3-[3-oxo-9-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfanyl)-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-9-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfanyl)-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155710381 |
| Molecular Formula | C22H15N5O3S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 3-[3-oxo-9-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfanyl)-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc4c(Sc5c[nH]c6ncccc56)cnc2c34)C(=O)N1 |
| InChI | InChI=1S/C22H15N5O3S/c28-17-7-6-14(21(29)26-17)27-20-18-11(3-1-4-13(18)22(27)30)15(10-25-20)31-16-9-24-19-12(16)5-2-8-23-19/h1-5,8-10,14H,6-7H2,(H,23,24)(H,26,28,29) |
| InChIKey | NLQNYTZDNAPYJY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|