C22H15F2N3O3 — CID 155710177
3-[9-[difluoro(phenyl)methyl]-3-oxo-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione (PubChem CID 155710177) has the molecular formula C22H15F2N3O3 and a molecular weight of 407.38 g/mol. Its IUPAC name is 3-[9-[difluoro(phenyl)methyl]-3-oxo-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[9-[difluoro(phenyl)methyl]-3-oxo-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155710177 |
| Molecular Formula | C22H15F2N3O3 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 3-[9-[difluoro(phenyl)methyl]-3-oxo-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc4c(C(F)(F)c5ccccc5)cnc2c34)C(=O)N1 |
| InChI | InChI=1S/C22H15F2N3O3/c23-22(24,12-5-2-1-3-6-12)15-11-25-19-18-13(15)7-4-8-14(18)21(30)27(19)16-9-10-17(28)26-20(16)29/h1-8,11,16H,9-10H2,(H,26,28,29) |
| InChIKey | NYTVHYBHXLWPAX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|