C25H24N6O3 — CID 155710620
ethane;3-[9-[methyl(1H-pyrrolo[2,3-b]pyridin-3-yl)amino]-3-oxo-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione (PubChem CID 155710620) has the molecular formula C25H24N6O3 and a molecular weight of 456.51 g/mol. Its IUPAC name is ethane;3-[9-[methyl(1H-pyrrolo[2,3-b]pyridin-3-yl)amino]-3-oxo-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione.
| Compound Name | ethane;3-[9-[methyl(1H-pyrrolo[2,3-b]pyridin-3-yl)amino]-3-oxo-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155710620 |
| Molecular Formula | C25H24N6O3 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | ethane;3-[9-[methyl(1H-pyrrolo[2,3-b]pyridin-3-yl)amino]-3-oxo-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-2-yl]piperidine-2,6-dione |
| SMILES | CC.CN(c1c[nH]c2ncccc12)c1cnc2c3c(cccc13)C(=O)N2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C23H18N6O3.C2H6/c1-28(17-10-25-20-13(17)6-3-9-24-20)16-11-26-21-19-12(16)4-2-5-14(19)23(32)29(21)15-7-8-18(30)27-22(15)31;1-2/h2-6,9-11,15H,7-8H2,1H3,(H,24,25)(H,27,30,31);1-2H3 |
| InChIKey | HJCZXJARNQXPGI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|