C36H29F2N5O4 — CID 177335003
4-[4-[(Z)-1-[4-[[1-[(3S)-2,6-dioxopiperidin-3-yl]-2-oxobenzo[cd]indol-6-yl]methyl]-3-fluorophenyl]-2-hydroxyethenyl]piperazin-1-yl]-3-fluorobenzonitrile (PubChem CID 177335003) has the molecular formula C36H29F2N5O4 and a molecular weight of 633.66 g/mol. Its IUPAC name is 4-[4-[(Z)-1-[4-[[1-[(3S)-2,6-dioxopiperidin-3-yl]-2-oxobenzo[cd]indol-6-yl]methyl]-3-fluorophenyl]-2-hydroxyethenyl]piperazin-1-yl]-3-fluorobenzonitrile.
| Compound Name | 4-[4-[(Z)-1-[4-[[1-[(3S)-2,6-dioxopiperidin-3-yl]-2-oxobenzo[cd]indol-6-yl]methyl]-3-fluorophenyl]-2-hydroxyethenyl]piperazin-1-yl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 177335003 |
| Molecular Formula | C36H29F2N5O4 |
| Molecular Weight | 633.66 g/mol |
| Exact Mass | 633.22 |
| IUPAC Name | 4-[4-[(Z)-1-[4-[[1-[(3S)-2,6-dioxopiperidin-3-yl]-2-oxobenzo[cd]indol-6-yl]methyl]-3-fluorophenyl]-2-hydroxyethenyl]piperazin-1-yl]-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(N2CCN(/C(=C\O)c3ccc(Cc4ccc5c6c(cccc46)C(=O)N5[C@H]4CCC(=O)NC4=O)c(F)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C36H29F2N5O4/c37-27-18-24(32(20-44)42-14-12-41(13-15-42)29-8-4-21(19-39)16-28(29)38)6-5-23(27)17-22-7-9-30-34-25(22)2-1-3-26(34)36(47)43(30)31-10-11-33(45)40-35(31)46/h1-9,16,18,20,31,44H,10-15,17H2,(H,40,45,46)/b32-20-/t31-/m0/s1 |
| InChIKey | AVZHUDIKERCCJG-BKVCTLOGSA-N |
| XLogP | 5.02 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|