C29H27N3O5 — CID 155195098
4-[4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]methyl]phenyl]piperidine-1-carboxylic acid (PubChem CID 155195098) has the molecular formula C29H27N3O5 and a molecular weight of 497.55 g/mol. Its IUPAC name is 4-[4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]methyl]phenyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]methyl]phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 155195098 |
| Molecular Formula | C29H27N3O5 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 4-[4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]methyl]phenyl]piperidine-1-carboxylic acid |
| SMILES | O=C1CCC(N2C(=O)c3cccc4c(Cc5ccc(C6CCN(C(=O)O)CC6)cc5)ccc2c34)C(=O)N1 |
| InChI | InChI=1S/C29H27N3O5/c33-25-11-10-24(27(34)30-25)32-23-9-8-20(21-2-1-3-22(26(21)23)28(32)35)16-17-4-6-18(7-5-17)19-12-14-31(15-13-19)29(36)37/h1-9,19,24H,10-16H2,(H,36,37)(H,30,33,34) |
| InChIKey | SUJMMBCSRCYDGO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|