C27H31N3O5 — CID 167471119
tert-butyl 4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]methyl]piperidine-1-carboxylate (PubChem CID 167471119) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is tert-butyl 4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167471119 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | tert-butyl 4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cc2ccc3c4c(cccc24)C(=O)N3C2CCC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C27H31N3O5/c1-27(2,3)35-26(34)29-13-11-16(12-14-29)15-17-7-8-20-23-18(17)5-4-6-19(23)25(33)30(20)21-9-10-22(31)28-24(21)32/h4-8,16,21H,9-15H2,1-3H3,(H,28,31,32) |
| InChIKey | SYSRHHKLVDHCFM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|