C31H32N6O5 — CID 164836537
tert-butyl 4-[4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]methyl]pyrazol-1-yl]-4-isocyanopiperidine-1-carboxylate (PubChem CID 164836537) has the molecular formula C31H32N6O5 and a molecular weight of 568.63 g/mol. Its IUPAC name is tert-butyl 4-[4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]methyl]pyrazol-1-yl]-4-isocyanopiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]methyl]pyrazol-1-yl]-4-isocyanopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 164836537 |
| Molecular Formula | C31H32N6O5 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | tert-butyl 4-[4-[[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]methyl]pyrazol-1-yl]-4-isocyanopiperidine-1-carboxylate |
| SMILES | [C-]#[N+]C1(n2cc(Cc3ccc4c5c(cccc35)C(=O)N4C3CCC(=O)NC3=O)cn2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C31H32N6O5/c1-30(2,3)42-29(41)35-14-12-31(32-4,13-15-35)36-18-19(17-33-36)16-20-8-9-23-26-21(20)6-5-7-22(26)28(40)37(23)24-10-11-25(38)34-27(24)39/h5-9,17-18,24H,10-16H2,1-3H3,(H,34,38,39) |
| InChIKey | GXKWCDHAYHOFRE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|