C26H27F2N3O5 — CID 167470913
tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]-3,3-difluoropiperidine-1-carboxylate (PubChem CID 167470913) has the molecular formula C26H27F2N3O5 and a molecular weight of 499.51 g/mol. Its IUPAC name is tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]-3,3-difluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]-3,3-difluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 167470913 |
| Molecular Formula | C26H27F2N3O5 |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indol-6-yl]-3,3-difluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc3c4c(cccc24)C(=O)N3C2CCC(=O)NC2=O)C(F)(F)C1 |
| InChI | InChI=1S/C26H27F2N3O5/c1-25(2,3)36-24(35)30-12-11-17(26(27,28)13-30)14-7-8-18-21-15(14)5-4-6-16(21)23(34)31(18)19-9-10-20(32)29-22(19)33/h4-8,17,19H,9-13H2,1-3H3,(H,29,32,33) |
| InChIKey | OPZZYKOFVUYFSW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|