C31H35N5O6 — CID 155208197
tert-butyl 4-[[(E)-3-amino-2-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indole-6-carbonyl]prop-2-enylidene]amino]-4-methylpiperidine-1-carboxylate (PubChem CID 155208197) has the molecular formula C31H35N5O6 and a molecular weight of 573.65 g/mol. Its IUPAC name is tert-butyl 4-[[(E)-3-amino-2-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indole-6-carbonyl]prop-2-enylidene]amino]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(E)-3-amino-2-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indole-6-carbonyl]prop-2-enylidene]amino]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 155208197 |
| Molecular Formula | C31H35N5O6 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | tert-butyl 4-[[(E)-3-amino-2-[1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indole-6-carbonyl]prop-2-enylidene]amino]-4-methylpiperidine-1-carboxylate |
| SMILES | CC1(/N=C/C(=C\N)C(=O)c2ccc3c4c(cccc24)C(=O)N3C2CCC(=O)NC2=O)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C31H35N5O6/c1-30(2,3)42-29(41)35-14-12-31(4,13-15-35)33-17-18(16-32)26(38)20-8-9-22-25-19(20)6-5-7-21(25)28(40)36(22)23-10-11-24(37)34-27(23)39/h5-9,16-17,23H,10-15,32H2,1-4H3,(H,34,37,39)/b18-16+,33-17+ |
| InChIKey | CUJJYEOAPHGRTC-MJYHMFDBSA-N |
| XLogP | 3.49 |
| TPSA | 151.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|