C34H37N3O3 — CID 155207649
3-[6-[[4-(3-azaspiro[5.5]undecan-3-ylmethyl)phenyl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione (PubChem CID 155207649) has the molecular formula C34H37N3O3 and a molecular weight of 535.69 g/mol. Its IUPAC name is 3-[6-[[4-(3-azaspiro[5.5]undecan-3-ylmethyl)phenyl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[4-(3-azaspiro[5.5]undecan-3-ylmethyl)phenyl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155207649 |
| Molecular Formula | C34H37N3O3 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 3-[6-[[4-(3-azaspiro[5.5]undecan-3-ylmethyl)phenyl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc4c(Cc5ccc(CN6CCC7(CCCCC7)CC6)cc5)ccc2c34)C(=O)N1 |
| InChI | InChI=1S/C34H37N3O3/c38-30-14-13-29(32(39)35-30)37-28-12-11-25(26-5-4-6-27(31(26)28)33(37)40)21-23-7-9-24(10-8-23)22-36-19-17-34(18-20-36)15-2-1-3-16-34/h4-12,29H,1-3,13-22H2,(H,35,38,39) |
| InChIKey | DRXVDELVCGVSDN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|