C16H21N3O2 — CID 166899562
(3S)-3-(4-piperidin-4-ylanilino)piperidine-2,6-dione (PubChem CID 166899562) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (3S)-3-(4-piperidin-4-ylanilino)piperidine-2,6-dione.
| Compound Name | (3S)-3-(4-piperidin-4-ylanilino)piperidine-2,6-dione |
|---|---|
| PubChem CID | 166899562 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (3S)-3-(4-piperidin-4-ylanilino)piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](Nc2ccc(C3CCNCC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C16H21N3O2/c20-15-6-5-14(16(21)19-15)18-13-3-1-11(2-4-13)12-7-9-17-10-8-12/h1-4,12,14,17-18H,5-10H2,(H,19,20,21)/t14-/m0/s1 |
| InChIKey | WVVFLRPIVNZLID-AWEZNQCLSA-N |
| XLogP | 1.37 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|