C21H30N4O2 — CID 164719832
3-[4-(4-piperidin-4-ylpiperidin-1-yl)anilino]piperidine-2,6-dione (PubChem CID 164719832) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 3-[4-(4-piperidin-4-ylpiperidin-1-yl)anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-(4-piperidin-4-ylpiperidin-1-yl)anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164719832 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 3-[4-(4-piperidin-4-ylpiperidin-1-yl)anilino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2ccc(N3CCC(C4CCNCC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C21H30N4O2/c26-20-6-5-19(21(27)24-20)23-17-1-3-18(4-2-17)25-13-9-16(10-14-25)15-7-11-22-12-8-15/h1-4,15-16,19,22-23H,5-14H2,(H,24,26,27) |
| InChIKey | SMOJQJIZGUUBAY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|