C20H29N3O3 — CID 168735312
3-[4-(4-tert-butyl-4-hydroxypiperidin-1-yl)anilino]piperidine-2,6-dione (PubChem CID 168735312) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 3-[4-(4-tert-butyl-4-hydroxypiperidin-1-yl)anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-(4-tert-butyl-4-hydroxypiperidin-1-yl)anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168735312 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 3-[4-(4-tert-butyl-4-hydroxypiperidin-1-yl)anilino]piperidine-2,6-dione |
| SMILES | CC(C)(C)C1(O)CCN(c2ccc(NC3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C20H29N3O3/c1-19(2,3)20(26)10-12-23(13-11-20)15-6-4-14(5-7-15)21-16-8-9-17(24)22-18(16)25/h4-7,16,21,26H,8-13H2,1-3H3,(H,22,24,25) |
| InChIKey | NJQCHIURAPIKSS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|