C31H40N4O4 — CID 164720580
tert-butyl 5-[[1-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-4-yl]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 164720580) has the molecular formula C31H40N4O4 and a molecular weight of 532.69 g/mol. Its IUPAC name is tert-butyl 5-[[1-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-4-yl]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 5-[[1-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-4-yl]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 164720580 |
| Molecular Formula | C31H40N4O4 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | tert-butyl 5-[[1-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperidin-4-yl]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(CC3CCN(c4ccc(NC5CCC(=O)NC5=O)cc4)CC3)cccc2C1 |
| InChI | InChI=1S/C31H40N4O4/c1-31(2,3)39-30(38)35-18-15-26-22(5-4-6-23(26)20-35)19-21-13-16-34(17-14-21)25-9-7-24(8-10-25)32-27-11-12-28(36)33-29(27)37/h4-10,21,27,32H,11-20H2,1-3H3,(H,33,36,37) |
| InChIKey | HJFBUURATGIOEW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|