C21H31N3O4 — CID 166472102
ethane;3-[4-[4-hydroxy-4-(2-oxopropyl)piperidin-1-yl]anilino]piperidine-2,6-dione (PubChem CID 166472102) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is ethane;3-[4-[4-hydroxy-4-(2-oxopropyl)piperidin-1-yl]anilino]piperidine-2,6-dione.
| Compound Name | ethane;3-[4-[4-hydroxy-4-(2-oxopropyl)piperidin-1-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166472102 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | ethane;3-[4-[4-hydroxy-4-(2-oxopropyl)piperidin-1-yl]anilino]piperidine-2,6-dione |
| SMILES | CC.CC(=O)CC1(O)CCN(c2ccc(NC3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C19H25N3O4.C2H6/c1-13(23)12-19(26)8-10-22(11-9-19)15-4-2-14(3-5-15)20-16-6-7-17(24)21-18(16)25;1-2/h2-5,16,20,26H,6-12H2,1H3,(H,21,24,25);1-2H3 |
| InChIKey | GYBGAGXLWAUDHK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|