C18H22BrN3O5 — CID 162726394
2-[1-[2-bromo-4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-4-hydroxypiperidin-4-yl]acetic acid (PubChem CID 162726394) has the molecular formula C18H22BrN3O5 and a molecular weight of 440.29 g/mol. Its IUPAC name is 2-[1-[2-bromo-4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-4-hydroxypiperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[2-bromo-4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-4-hydroxypiperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 162726394 |
| Molecular Formula | C18H22BrN3O5 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 2-[1-[2-bromo-4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]-4-hydroxypiperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1(O)CCN(c2ccc(NC3CCC(=O)NC3=O)cc2Br)CC1 |
| InChI | InChI=1S/C18H22BrN3O5/c19-12-9-11(20-13-2-4-15(23)21-17(13)26)1-3-14(12)22-7-5-18(27,6-8-22)10-16(24)25/h1,3,9,13,20,27H,2,4-8,10H2,(H,24,25)(H,21,23,26) |
| InChIKey | HREPBSATHWXFIJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|