C17H21FN4O5 — CID 156505941
2-[1-[5-[[(3R)-2,6-dioxopiperidin-3-yl]amino]-3-fluoro-2-pyridinyl]-4-hydroxypiperidin-4-yl]acetic acid (PubChem CID 156505941) has the molecular formula C17H21FN4O5 and a molecular weight of 380.38 g/mol. Its IUPAC name is 2-[1-[5-[[(3R)-2,6-dioxopiperidin-3-yl]amino]-3-fluoro-2-pyridinyl]-4-hydroxypiperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[5-[[(3R)-2,6-dioxopiperidin-3-yl]amino]-3-fluoro-2-pyridinyl]-4-hydroxypiperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 156505941 |
| Molecular Formula | C17H21FN4O5 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-[1-[5-[[(3R)-2,6-dioxopiperidin-3-yl]amino]-3-fluoro-2-pyridinyl]-4-hydroxypiperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1(O)CCN(c2ncc(N[C@@H]3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C17H21FN4O5/c18-11-7-10(20-12-1-2-13(23)21-16(12)26)9-19-15(11)22-5-3-17(27,4-6-22)8-14(24)25/h7,9,12,20,27H,1-6,8H2,(H,24,25)(H,21,23,26)/t12-/m1/s1 |
| InChIKey | LZSFKKXWUOAFEN-GFCCVEGCSA-N |
| XLogP | 0.24 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|