C21H27FN8O2 — CID 177300960
3-[[5-fluoro-6-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)piperazin-1-yl]-3-pyridinyl]amino]piperidine-2,6-dione (PubChem CID 177300960) has the molecular formula C21H27FN8O2 and a molecular weight of 442.50 g/mol. Its IUPAC name is 3-[[5-fluoro-6-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)piperazin-1-yl]-3-pyridinyl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[5-fluoro-6-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)piperazin-1-yl]-3-pyridinyl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177300960 |
| Molecular Formula | C21H27FN8O2 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 3-[[5-fluoro-6-[4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylmethyl)piperazin-1-yl]-3-pyridinyl]amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2cnc(N3CCN(Cc4cc5n(n4)CCNC5)CC3)c(F)c2)C(=O)N1 |
| InChI | InChI=1S/C21H27FN8O2/c22-17-10-14(25-18-1-2-19(31)26-21(18)32)11-24-20(17)29-7-5-28(6-8-29)13-15-9-16-12-23-3-4-30(16)27-15/h9-11,18,23,25H,1-8,12-13H2,(H,26,31,32) |
| InChIKey | FUNFEUIKXWAKDT-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|