C10H10FN3O2 — CID 166472267
3-[(5-fluoro-3-pyridinyl)amino]piperidine-2,6-dione (PubChem CID 166472267) has the molecular formula C10H10FN3O2 and a molecular weight of 223.21 g/mol. Its IUPAC name is 3-[(5-fluoro-3-pyridinyl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(5-fluoro-3-pyridinyl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166472267 |
| Molecular Formula | C10H10FN3O2 |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3-[(5-fluoro-3-pyridinyl)amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2cncc(F)c2)C(=O)N1 |
| InChI | InChI=1S/C10H10FN3O2/c11-6-3-7(5-12-4-6)13-8-1-2-9(15)14-10(8)16/h3-5,8,13H,1-2H2,(H,14,15,16) |
| InChIKey | CLWNCYNZNCORFG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|