C16H19ClF3N3O2 — CID 166168179
3-[4-(3,3-difluoropiperidin-4-yl)-3-fluoroanilino]piperidine-2,6-dione;hydrochloride (PubChem CID 166168179) has the molecular formula C16H19ClF3N3O2 and a molecular weight of 377.79 g/mol. Its IUPAC name is 3-[4-(3,3-difluoropiperidin-4-yl)-3-fluoroanilino]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[4-(3,3-difluoropiperidin-4-yl)-3-fluoroanilino]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 166168179 |
| Molecular Formula | C16H19ClF3N3O2 |
| Molecular Weight | 377.79 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 3-[4-(3,3-difluoropiperidin-4-yl)-3-fluoroanilino]piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.O=C1CCC(Nc2ccc(C3CCNCC3(F)F)c(F)c2)C(=O)N1 |
| InChI | InChI=1S/C16H18F3N3O2.ClH/c17-12-7-9(21-13-3-4-14(23)22-15(13)24)1-2-10(12)11-5-6-20-8-16(11,18)19;/h1-2,7,11,13,20-21H,3-6,8H2,(H,22,23,24);1H |
| InChIKey | ASPPJRWDFJHHCK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.79 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|