C17H22FN3O3 — CID 166168100
(3S)-3-[3-fluoro-4-[(3S,4S)-3-methoxypiperidin-4-yl]anilino]piperidine-2,6-dione (PubChem CID 166168100) has the molecular formula C17H22FN3O3 and a molecular weight of 335.38 g/mol. Its IUPAC name is (3S)-3-[3-fluoro-4-[(3S,4S)-3-methoxypiperidin-4-yl]anilino]piperidine-2,6-dione.
| Compound Name | (3S)-3-[3-fluoro-4-[(3S,4S)-3-methoxypiperidin-4-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166168100 |
| Molecular Formula | C17H22FN3O3 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (3S)-3-[3-fluoro-4-[(3S,4S)-3-methoxypiperidin-4-yl]anilino]piperidine-2,6-dione |
| SMILES | CO[C@@H]1CNCC[C@H]1c1ccc(N[C@H]2CCC(=O)NC2=O)cc1F |
| InChI | InChI=1S/C17H22FN3O3/c1-24-15-9-19-7-6-12(15)11-3-2-10(8-13(11)18)20-14-4-5-16(22)21-17(14)23/h2-3,8,12,14-15,19-20H,4-7,9H2,1H3,(H,21,22,23)/t12-,14-,15+/m0/s1 |
| InChIKey | JIRMJWOKXZRLKB-AEGPPILISA-N |
| XLogP | 1.13 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|