C22H30FN3O5 — CID 166168460
tert-butyl (3R,4R)-4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]-3-methoxypiperidine-1-carboxylate (PubChem CID 166168460) has the molecular formula C22H30FN3O5 and a molecular weight of 435.50 g/mol. Its IUPAC name is tert-butyl (3R,4R)-4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]-3-methoxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]-3-methoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 166168460 |
| Molecular Formula | C22H30FN3O5 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | tert-butyl (3R,4R)-4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]-3-methoxypiperidine-1-carboxylate |
| SMILES | CO[C@H]1CN(C(=O)OC(C)(C)C)CC[C@@H]1c1ccc(NC2CCC(=O)NC2=O)cc1F |
| InChI | InChI=1S/C22H30FN3O5/c1-22(2,3)31-21(29)26-10-9-15(18(12-26)30-4)14-6-5-13(11-16(14)23)24-17-7-8-19(27)25-20(17)28/h5-6,11,15,17-18,24H,7-10,12H2,1-4H3,(H,25,27,28)/t15-,17?,18+/m1/s1 |
| InChIKey | MTEYPKTVDNEJGB-IKJNGHJTSA-N |
| XLogP | 2.78 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|