C19H26FN5O4 — CID 166117069
tert-butyl 4-[5-[(2,6-dioxopiperidin-3-yl)amino]-3-fluoro-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 166117069) has the molecular formula C19H26FN5O4 and a molecular weight of 407.45 g/mol. Its IUPAC name is tert-butyl 4-[5-[(2,6-dioxopiperidin-3-yl)amino]-3-fluoro-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[(2,6-dioxopiperidin-3-yl)amino]-3-fluoro-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166117069 |
| Molecular Formula | C19H26FN5O4 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | tert-butyl 4-[5-[(2,6-dioxopiperidin-3-yl)amino]-3-fluoro-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncc(NC3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C19H26FN5O4/c1-19(2,3)29-18(28)25-8-6-24(7-9-25)16-13(20)10-12(11-21-16)22-14-4-5-15(26)23-17(14)27/h10-11,14,22H,4-9H2,1-3H3,(H,23,26,27) |
| InChIKey | GNBQTXHWDBYOJR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|