C28H43FN4O4 — CID 170749705
tert-butyl 4-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperidin-4-yl]piperidine-1-carboxylate;ethane (PubChem CID 170749705) has the molecular formula C28H43FN4O4 and a molecular weight of 518.67 g/mol. Its IUPAC name is tert-butyl 4-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperidin-4-yl]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperidin-4-yl]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 170749705 |
| Molecular Formula | C28H43FN4O4 |
| Molecular Weight | 518.67 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | tert-butyl 4-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperidin-4-yl]piperidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCC(C2CCN(c3ccc(NC4CCC(=O)NC4=O)cc3F)CC2)CC1 |
| InChI | InChI=1S/C26H37FN4O4.C2H6/c1-26(2,3)35-25(34)31-14-10-18(11-15-31)17-8-12-30(13-9-17)22-6-4-19(16-20(22)27)28-21-5-7-23(32)29-24(21)33;1-2/h4,6,16-18,21,28H,5,7-15H2,1-3H3,(H,29,32,33);1-2H3 |
| InChIKey | PIDQCMJGHNTLKB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|