C26H37F2N5O4 — CID 172591958
tert-butyl 4-[[4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperazin-1-yl]methyl]-4-fluoropiperidine-1-carboxylate (PubChem CID 172591958) has the molecular formula C26H37F2N5O4 and a molecular weight of 521.61 g/mol. Its IUPAC name is tert-butyl 4-[[4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperazin-1-yl]methyl]-4-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperazin-1-yl]methyl]-4-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 172591958 |
| Molecular Formula | C26H37F2N5O4 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | tert-butyl 4-[[4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperazin-1-yl]methyl]-4-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(CN2CCN(c3ccc(NC4CCC(=O)NC4=O)cc3F)CC2)CC1 |
| InChI | InChI=1S/C26H37F2N5O4/c1-25(2,3)37-24(36)33-10-8-26(28,9-11-33)17-31-12-14-32(15-13-31)21-6-4-18(16-19(21)27)29-20-5-7-22(34)30-23(20)35/h4,6,16,20,29H,5,7-15,17H2,1-3H3,(H,30,34,35) |
| InChIKey | TXHQYDUQRPREIN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|