C28H42FN5O4 — CID 171637388
tert-butyl N-[1-[2-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperidin-4-yl]ethyl]piperidin-4-yl]carbamate (PubChem CID 171637388) has the molecular formula C28H42FN5O4 and a molecular weight of 531.67 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperidin-4-yl]ethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperidin-4-yl]ethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 171637388 |
| Molecular Formula | C28H42FN5O4 |
| Molecular Weight | 531.67 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | tert-butyl N-[1-[2-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperidin-4-yl]ethyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CCC2CCN(c3ccc(NC4CCC(=O)NC4=O)cc3F)CC2)CC1 |
| InChI | InChI=1S/C28H42FN5O4/c1-28(2,3)38-27(37)31-20-11-14-33(15-12-20)13-8-19-9-16-34(17-10-19)24-6-4-21(18-22(24)29)30-23-5-7-25(35)32-26(23)36/h4,6,18-20,23,30H,5,7-17H2,1-3H3,(H,31,37)(H,32,35,36) |
| InChIKey | APEZUWPPITYIAS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.67 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|