About [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid
[5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid (PubChem CID 154941373) has the molecular formula C12H12FN3O4
and a molecular weight of 281.24 g/mol. Its IUPAC name is [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid.
Molecular Properties
| Compound Name | [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid |
| PubChem CID | 154941373 |
| Molecular Formula | C12H12FN3O4 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid |
| SMILES | O=C(O)Nc1cc(NC2CCC(=O)NC2=O)ccc1F |
| InChI | InChI=1S/C12H12FN3O4/c13-7-2-1-6(5-9(7)15-12(19)20)14-8-3-4-10(17)16-11(8)18/h1-2,5,8,14-15H,3-4H2,(H,19,20)(H,16,17,18) |
| InChIKey | UHVKWFDKXWATRQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid?
The IUPAC name of [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid (CID 154941373) is [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid.
What is the SMILES notation for [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid?
The canonical SMILES for [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid is O=C(O)Nc1cc(NC2CCC(=O)NC2=O)ccc1F.
What is the InChIKey of [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid?
The InChIKey is UHVKWFDKXWATRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FN3O4/c13-7-2-1-6(5-9(7)15-12(19)20)14-8-3-4-10(17)16-11(8)18/h1-2,5,8,14-15H,3-4H2,(H,19,20)(H,16,17,18).
What are the key properties of [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid?
[5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid has a molecular weight of 281.24 g/mol, XLogP of 1.13, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid is sourced from PubChem (CID 154941373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).