C12H12FN3O4 — CID 154941373
[5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid (PubChem CID 154941373) has the molecular formula C12H12FN3O4 and a molecular weight of 281.24 g/mol. Its IUPAC name is [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid.
| Compound Name | [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid |
|---|---|
| PubChem CID | 154941373 |
| Molecular Formula | C12H12FN3O4 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | [5-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]carbamic acid |
| SMILES | O=C(O)Nc1cc(NC2CCC(=O)NC2=O)ccc1F |
| InChI | InChI=1S/C12H12FN3O4/c13-7-2-1-6(5-9(7)15-12(19)20)14-8-3-4-10(17)16-11(8)18/h1-2,5,8,14-15H,3-4H2,(H,19,20)(H,16,17,18) |
| InChIKey | UHVKWFDKXWATRQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|