C13H14F2N2O2 — CID 176683649
3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione (PubChem CID 176683649) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione.
| Compound Name | 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione |
|---|---|
| PubChem CID | 176683649 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione |
| SMILES | CCc1cc(F)c(NC2CCC(=O)NC2=O)cc1F |
| InChI | InChI=1S/C13H14F2N2O2/c1-2-7-5-9(15)11(6-8(7)14)16-10-3-4-12(18)17-13(10)19/h5-6,10,16H,2-4H2,1H3,(H,17,18,19) |
| InChIKey | MARHVICHGOOIAJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|