About 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione
3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione (PubChem CID 176683649) has the molecular formula C13H14F2N2O2
and a molecular weight of 268.26 g/mol. Its IUPAC name is 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione.
Molecular Properties
| Compound Name | 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione |
| PubChem CID | 176683649 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione |
| SMILES | CCc1cc(F)c(NC2CCC(=O)NC2=O)cc1F |
| InChI | InChI=1S/C13H14F2N2O2/c1-2-7-5-9(15)11(6-8(7)14)16-10-3-4-12(18)17-13(10)19/h5-6,10,16H,2-4H2,1H3,(H,17,18,19) |
| InChIKey | MARHVICHGOOIAJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione?
The IUPAC name of 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione (CID 176683649) is 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione.
What is the SMILES notation for 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione?
The canonical SMILES for 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione is CCc1cc(F)c(NC2CCC(=O)NC2=O)cc1F.
What is the InChIKey of 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione?
The InChIKey is MARHVICHGOOIAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N2O2/c1-2-7-5-9(15)11(6-8(7)14)16-10-3-4-12(18)17-13(10)19/h5-6,10,16H,2-4H2,1H3,(H,17,18,19).
What are the key properties of 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione?
3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione has a molecular weight of 268.26 g/mol, XLogP of 1.74, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-ethyl-2,5-difluoroanilino)piperidine-2,6-dione is sourced from PubChem (CID 176683649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).