C15H21ClN2O2 — CID 170749493
3-(3-chloro-4-ethylanilino)piperidine-2,6-dione;ethane (PubChem CID 170749493) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 3-(3-chloro-4-ethylanilino)piperidine-2,6-dione;ethane.
| Compound Name | 3-(3-chloro-4-ethylanilino)piperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 170749493 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-(3-chloro-4-ethylanilino)piperidine-2,6-dione;ethane |
| SMILES | CC.CCc1ccc(NC2CCC(=O)NC2=O)cc1Cl |
| InChI | InChI=1S/C13H15ClN2O2.C2H6/c1-2-8-3-4-9(7-10(8)14)15-11-5-6-12(17)16-13(11)18;1-2/h3-4,7,11,15H,2,5-6H2,1H3,(H,16,17,18);1-2H3 |
| InChIKey | LXBLECUETNFCAV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|