C15H22N2O2 — CID 170586483
ethane;3-(3-ethylanilino)piperidine-2,6-dione (PubChem CID 170586483) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is ethane;3-(3-ethylanilino)piperidine-2,6-dione.
| Compound Name | ethane;3-(3-ethylanilino)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170586483 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | ethane;3-(3-ethylanilino)piperidine-2,6-dione |
| SMILES | CC.CCc1cccc(NC2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C13H16N2O2.C2H6/c1-2-9-4-3-5-10(8-9)14-11-6-7-12(16)15-13(11)17;1-2/h3-5,8,11,14H,2,6-7H2,1H3,(H,15,16,17);1-2H3 |
| InChIKey | SZMJDLAAIJRBIJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|