C14H18N2O4 — CID 60933972
3-[3-(2-methoxyethoxymethyl)anilino]pyrrolidine-2,5-dione (PubChem CID 60933972) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-[3-(2-methoxyethoxymethyl)anilino]pyrrolidine-2,5-dione.
| Compound Name | 3-[3-(2-methoxyethoxymethyl)anilino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 60933972 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3-[3-(2-methoxyethoxymethyl)anilino]pyrrolidine-2,5-dione |
| SMILES | COCCOCc1cccc(NC2CC(=O)NC2=O)c1 |
| InChI | InChI=1S/C14H18N2O4/c1-19-5-6-20-9-10-3-2-4-11(7-10)15-12-8-13(17)16-14(12)18/h2-4,7,12,15H,5-6,8-9H2,1H3,(H,16,17,18) |
| InChIKey | CNPUAABVMCOIIL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|