C20H23NO3 — CID 96531230
(3S,5R)-5-methyl-3-[3-(2-phenylethoxymethyl)anilino]oxolan-2-one (PubChem CID 96531230) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (3S,5R)-5-methyl-3-[3-(2-phenylethoxymethyl)anilino]oxolan-2-one.
| Compound Name | (3S,5R)-5-methyl-3-[3-(2-phenylethoxymethyl)anilino]oxolan-2-one |
|---|---|
| PubChem CID | 96531230 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (3S,5R)-5-methyl-3-[3-(2-phenylethoxymethyl)anilino]oxolan-2-one |
| SMILES | C[C@@H]1C[C@H](Nc2cccc(COCCc3ccccc3)c2)C(=O)O1 |
| InChI | InChI=1S/C20H23NO3/c1-15-12-19(20(22)24-15)21-18-9-5-8-17(13-18)14-23-11-10-16-6-3-2-4-7-16/h2-9,13,15,19,21H,10-12,14H2,1H3/t15-,19+/m1/s1 |
| InChIKey | ZARHNBMILZJWRV-BEFAXECRSA-N |
| XLogP | 3.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|