About 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile
3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile (PubChem CID 97212911) has the molecular formula C19H17FN2O3
and a molecular weight of 340.35 g/mol. Its IUPAC name is 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile |
| PubChem CID | 97212911 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile |
| SMILES | C[C@@H]1C[C@H](Nc2ccc(OCc3cccc(C#N)c3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H17FN2O3/c1-12-7-17(19(23)25-12)22-15-5-6-18(16(20)9-15)24-11-14-4-2-3-13(8-14)10-21/h2-6,8-9,12,17,22H,7,11H2,1H3/t12-,17+/m1/s1 |
| InChIKey | BROHFMBWPDHMGX-PXAZEXFGSA-N |
| XLogP | 3.39 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile?
The IUPAC name of 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile (CID 97212911) is 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile.
What is the SMILES notation for 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile?
The canonical SMILES for 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile is C[C@@H]1C[C@H](Nc2ccc(OCc3cccc(C#N)c3)c(F)c2)C(=O)O1.
What is the InChIKey of 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile?
The InChIKey is BROHFMBWPDHMGX-PXAZEXFGSA-N. The full InChI is InChI=1S/C19H17FN2O3/c1-12-7-17(19(23)25-12)22-15-5-6-18(16(20)9-15)24-11-14-4-2-3-13(8-14)10-21/h2-6,8-9,12,17,22H,7,11H2,1H3/t12-,17+/m1/s1.
What are the key properties of 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile?
3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile has a molecular weight of 340.35 g/mol, XLogP of 3.39, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile is sourced from PubChem (CID 97212911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).