C19H17FN2O3 — CID 97212911
3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile (PubChem CID 97212911) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile.
| Compound Name | 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 97212911 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-[[2-fluoro-4-[[(3S,5R)-5-methyl-2-oxooxolan-3-yl]amino]phenoxy]methyl]benzonitrile |
| SMILES | C[C@@H]1C[C@H](Nc2ccc(OCc3cccc(C#N)c3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H17FN2O3/c1-12-7-17(19(23)25-12)22-15-5-6-18(16(20)9-15)24-11-14-4-2-3-13(8-14)10-21/h2-6,8-9,12,17,22H,7,11H2,1H3/t12-,17+/m1/s1 |
| InChIKey | BROHFMBWPDHMGX-PXAZEXFGSA-N |
| XLogP | 3.39 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|